About 7-ethynylpyrido[2,3-b][1,4]oxazin-3-one
7-ethynylpyrido[2,3-b][1,4]oxazin-3-one (PubChem CID 156762822) has the molecular formula C9H4N2O2
and a molecular weight of 172.14 g/mol. Its IUPAC name is 7-ethynylpyrido[2,3-b][1,4]oxazin-3-one.
Molecular Properties
| Compound Name | 7-ethynylpyrido[2,3-b][1,4]oxazin-3-one |
| PubChem CID | 156762822 |
| Molecular Formula | C9H4N2O2 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | 7-ethynylpyrido[2,3-b][1,4]oxazin-3-one |
| SMILES | C#Cc1cnc2oc(=O)cnc2c1 |
| InChI | InChI=1S/C9H4N2O2/c1-2-6-3-7-9(11-4-6)13-8(12)5-10-7/h1,3-5H |
| InChIKey | JBIGYHKXBKVOIP-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-ethynylpyrido[2,3-b][1,4]oxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethynylpyrido[2,3-b][1,4]oxazin-3-one?
The IUPAC name of 7-ethynylpyrido[2,3-b][1,4]oxazin-3-one (CID 156762822) is 7-ethynylpyrido[2,3-b][1,4]oxazin-3-one.
What is the SMILES notation for 7-ethynylpyrido[2,3-b][1,4]oxazin-3-one?
The canonical SMILES for 7-ethynylpyrido[2,3-b][1,4]oxazin-3-one is C#Cc1cnc2oc(=O)cnc2c1.
What is the InChIKey of 7-ethynylpyrido[2,3-b][1,4]oxazin-3-one?
The InChIKey is JBIGYHKXBKVOIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4N2O2/c1-2-6-3-7-9(11-4-6)13-8(12)5-10-7/h1,3-5H.
What are the key properties of 7-ethynylpyrido[2,3-b][1,4]oxazin-3-one?
7-ethynylpyrido[2,3-b][1,4]oxazin-3-one has a molecular weight of 172.14 g/mol, XLogP of 0.56, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethynylpyrido[2,3-b][1,4]oxazin-3-one is sourced from PubChem (CID 156762822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).