C13H12ClF7O — CID 156763353
1-chloro-3-(4,4,5,5,6,6,6-heptafluoro-2-methoxyhexan-2-yl)benzene (PubChem CID 156763353) has the molecular formula C13H12ClF7O and a molecular weight of 352.68 g/mol. Its IUPAC name is 1-chloro-3-(4,4,5,5,6,6,6-heptafluoro-2-methoxyhexan-2-yl)benzene.
| Compound Name | 1-chloro-3-(4,4,5,5,6,6,6-heptafluoro-2-methoxyhexan-2-yl)benzene |
|---|---|
| PubChem CID | 156763353 |
| Molecular Formula | C13H12ClF7O |
| Molecular Weight | 352.68 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | 1-chloro-3-(4,4,5,5,6,6,6-heptafluoro-2-methoxyhexan-2-yl)benzene |
| SMILES | COC(C)(CC(F)(F)C(F)(F)C(F)(F)F)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H12ClF7O/c1-10(22-2,8-4-3-5-9(14)6-8)7-11(15,16)12(17,18)13(19,20)21/h3-6H,7H2,1-2H3 |
| InChIKey | UONMUMPYUHHSED-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.68 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|