C13H8F9NO — CID 156764211
2-(3,3,4,4,5,5,6,6,6-nonafluoro-1-hydroxyhexyl)benzonitrile (PubChem CID 156764211) has the molecular formula C13H8F9NO and a molecular weight of 365.20 g/mol. Its IUPAC name is 2-(3,3,4,4,5,5,6,6,6-nonafluoro-1-hydroxyhexyl)benzonitrile.
| Compound Name | 2-(3,3,4,4,5,5,6,6,6-nonafluoro-1-hydroxyhexyl)benzonitrile |
|---|---|
| PubChem CID | 156764211 |
| Molecular Formula | C13H8F9NO |
| Molecular Weight | 365.20 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | 2-(3,3,4,4,5,5,6,6,6-nonafluoro-1-hydroxyhexyl)benzonitrile |
| SMILES | N#Cc1ccccc1C(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H8F9NO/c14-10(15,11(16,17)12(18,19)13(20,21)22)5-9(24)8-4-2-1-3-7(8)6-23/h1-4,9,24H,5H2 |
| InChIKey | KPEODHXWLRYTLX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.20 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|