C16H10BrF15O — CID 156764751
2-(2-bromophenyl)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecan-2-ol (PubChem CID 156764751) has the molecular formula C16H10BrF15O and a molecular weight of 583.13 g/mol. Its IUPAC name is 2-(2-bromophenyl)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecan-2-ol.
| Compound Name | 2-(2-bromophenyl)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecan-2-ol |
|---|---|
| PubChem CID | 156764751 |
| Molecular Formula | C16H10BrF15O |
| Molecular Weight | 583.13 g/mol |
| Exact Mass | 581.97 |
| IUPAC Name | 2-(2-bromophenyl)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecan-2-ol |
| SMILES | CC(O)(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccccc1Br |
| InChI | InChI=1S/C16H10BrF15O/c1-9(33,7-4-2-3-5-8(7)17)6-10(18,19)11(20,21)12(22,23)13(24,25)14(26,27)15(28,29)16(30,31)32/h2-5,33H,6H2,1H3 |
| InChIKey | WFMOWBSBVUDGOU-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.13 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|