About (2-phenyl-1,3-benzothiazol-4-yl)methyl acetate
(2-phenyl-1,3-benzothiazol-4-yl)methyl acetate (PubChem CID 15676484) has the molecular formula C16H13NO2S
and a molecular weight of 283.35 g/mol. Its IUPAC name is (2-phenyl-1,3-benzothiazol-4-yl)methyl acetate.
Molecular Properties
| Compound Name | (2-phenyl-1,3-benzothiazol-4-yl)methyl acetate |
| PubChem CID | 15676484 |
| Molecular Formula | C16H13NO2S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | (2-phenyl-1,3-benzothiazol-4-yl)methyl acetate |
| SMILES | CC(=O)OCc1cccc2sc(-c3ccccc3)nc12 |
| InChI | InChI=1S/C16H13NO2S/c1-11(18)19-10-13-8-5-9-14-15(13)17-16(20-14)12-6-3-2-4-7-12/h2-9H,10H2,1H3 |
| InChIKey | AKZCIBODSHCTGE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-phenyl-1,3-benzothiazol-4-yl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phenyl-1,3-benzothiazol-4-yl)methyl acetate?
The IUPAC name of (2-phenyl-1,3-benzothiazol-4-yl)methyl acetate (CID 15676484) is (2-phenyl-1,3-benzothiazol-4-yl)methyl acetate.
What is the SMILES notation for (2-phenyl-1,3-benzothiazol-4-yl)methyl acetate?
The canonical SMILES for (2-phenyl-1,3-benzothiazol-4-yl)methyl acetate is CC(=O)OCc1cccc2sc(-c3ccccc3)nc12.
What is the InChIKey of (2-phenyl-1,3-benzothiazol-4-yl)methyl acetate?
The InChIKey is AKZCIBODSHCTGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO2S/c1-11(18)19-10-13-8-5-9-14-15(13)17-16(20-14)12-6-3-2-4-7-12/h2-9H,10H2,1H3.
What are the key properties of (2-phenyl-1,3-benzothiazol-4-yl)methyl acetate?
(2-phenyl-1,3-benzothiazol-4-yl)methyl acetate has a molecular weight of 283.35 g/mol, XLogP of 4.03, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenyl-1,3-benzothiazol-4-yl)methyl acetate is sourced from PubChem (CID 15676484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).