C12H9F9O — CID 156765029
3,3,4,4,5,5,6,6,6-nonafluoro-1-phenylhexan-1-ol (PubChem CID 156765029) has the molecular formula C12H9F9O and a molecular weight of 340.19 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,6-nonafluoro-1-phenylhexan-1-ol.
| Compound Name | 3,3,4,4,5,5,6,6,6-nonafluoro-1-phenylhexan-1-ol |
|---|---|
| PubChem CID | 156765029 |
| Molecular Formula | C12H9F9O |
| Molecular Weight | 340.19 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 3,3,4,4,5,5,6,6,6-nonafluoro-1-phenylhexan-1-ol |
| SMILES | OC(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C12H9F9O/c13-9(14,6-8(22)7-4-2-1-3-5-7)10(15,16)11(17,18)12(19,20)21/h1-5,8,22H,6H2 |
| InChIKey | ICQUUJWNIFSJKP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.19 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|