About thieno[3,2-c]pyridine-3-thiol
thieno[3,2-c]pyridine-3-thiol (PubChem CID 156766861) has the molecular formula C7H5NS2
and a molecular weight of 167.26 g/mol. Its IUPAC name is thieno[3,2-c]pyridine-3-thiol.
Molecular Properties
| Compound Name | thieno[3,2-c]pyridine-3-thiol |
| PubChem CID | 156766861 |
| Molecular Formula | C7H5NS2 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 166.99 |
| IUPAC Name | thieno[3,2-c]pyridine-3-thiol |
| SMILES | Sc1csc2ccncc12 |
| InChI | InChI=1S/C7H5NS2/c9-6-4-10-7-1-2-8-3-5(6)7/h1-4,9H |
| InChIKey | JWMWTEQAKWJLHC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze thieno[3,2-c]pyridine-3-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[3,2-c]pyridine-3-thiol?
The IUPAC name of thieno[3,2-c]pyridine-3-thiol (CID 156766861) is thieno[3,2-c]pyridine-3-thiol.
What is the SMILES notation for thieno[3,2-c]pyridine-3-thiol?
The canonical SMILES for thieno[3,2-c]pyridine-3-thiol is Sc1csc2ccncc12.
What is the InChIKey of thieno[3,2-c]pyridine-3-thiol?
The InChIKey is JWMWTEQAKWJLHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NS2/c9-6-4-10-7-1-2-8-3-5(6)7/h1-4,9H.
What are the key properties of thieno[3,2-c]pyridine-3-thiol?
thieno[3,2-c]pyridine-3-thiol has a molecular weight of 167.26 g/mol, XLogP of 2.59, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[3,2-c]pyridine-3-thiol is sourced from PubChem (CID 156766861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).