About 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane;hydrate
5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane;hydrate (PubChem CID 156767623) has the molecular formula C12H20N2O3
and a molecular weight of 240.30 g/mol. Its IUPAC name is 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane;hydrate.
Molecular Properties
| Compound Name | 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane;hydrate |
| PubChem CID | 156767623 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane;hydrate |
| SMILES | CC1(C)CC(N=C=O)CC(C)(CN=C=O)C1.O |
| InChI | InChI=1S/C12H18N2O2.H2O/c1-11(2)4-10(14-9-16)5-12(3,6-11)7-13-8-15;/h10H,4-7H2,1-3H3;1H2 |
| InChIKey | DSZLWOLJGMTGLI-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 90.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane;hydrate?
The IUPAC name of 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane;hydrate (CID 156767623) is 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane;hydrate.
What is the SMILES notation for 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane;hydrate?
The canonical SMILES for 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane;hydrate is CC1(C)CC(N=C=O)CC(C)(CN=C=O)C1.O.
What is the InChIKey of 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane;hydrate?
The InChIKey is DSZLWOLJGMTGLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O2.H2O/c1-11(2)4-10(14-9-16)5-12(3,6-11)7-13-8-15;/h10H,4-7H2,1-3H3;1H2.
What are the key properties of 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane;hydrate?
5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane;hydrate has a molecular weight of 240.30 g/mol, XLogP of 1.42, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane;hydrate is sourced from PubChem (CID 156767623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).