C27H22ClN5O3S — CID 156767714
N-[2-chloro-5-[4-[(4-methoxyphenyl)methylamino]cinnolin-6-yl]-3-pyridinyl]benzenesulfonamide (PubChem CID 156767714) has the molecular formula C27H22ClN5O3S and a molecular weight of 532.03 g/mol. Its IUPAC name is N-[2-chloro-5-[4-[(4-methoxyphenyl)methylamino]cinnolin-6-yl]-3-pyridinyl]benzenesulfonamide.
| Compound Name | N-[2-chloro-5-[4-[(4-methoxyphenyl)methylamino]cinnolin-6-yl]-3-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 156767714 |
| Molecular Formula | C27H22ClN5O3S |
| Molecular Weight | 532.03 g/mol |
| Exact Mass | 531.11 |
| IUPAC Name | N-[2-chloro-5-[4-[(4-methoxyphenyl)methylamino]cinnolin-6-yl]-3-pyridinyl]benzenesulfonamide |
| SMILES | COc1ccc(CNc2cnnc3ccc(-c4cnc(Cl)c(NS(=O)(=O)c5ccccc5)c4)cc23)cc1 |
| InChI | InChI=1S/C27H22ClN5O3S/c1-36-21-10-7-18(8-11-21)15-29-26-17-31-32-24-12-9-19(13-23(24)26)20-14-25(27(28)30-16-20)33-37(34,35)22-5-3-2-4-6-22/h2-14,16-17,33H,15H2,1H3,(H,29,32) |
| InChIKey | RZMIHGUZGYALDA-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.03 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|