About 3-methyldithietan-3-ol
3-methyldithietan-3-ol (PubChem CID 156768091) has the molecular formula C3H6OS2
and a molecular weight of 122.21 g/mol. Its IUPAC name is 3-methyldithietan-3-ol.
Molecular Properties
| Compound Name | 3-methyldithietan-3-ol |
| PubChem CID | 156768091 |
| Molecular Formula | C3H6OS2 |
| Molecular Weight | 122.21 g/mol |
| Exact Mass | 121.99 |
| IUPAC Name | 3-methyldithietan-3-ol |
| SMILES | CC1(O)CSS1 |
| InChI | InChI=1S/C3H6OS2/c1-3(4)2-5-6-3/h4H,2H2,1H3 |
| InChIKey | QLRWVDQEQOOIAW-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.21 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 3-methyldithietan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyldithietan-3-ol?
The IUPAC name of 3-methyldithietan-3-ol (CID 156768091) is 3-methyldithietan-3-ol.
What is the SMILES notation for 3-methyldithietan-3-ol?
The canonical SMILES for 3-methyldithietan-3-ol is CC1(O)CSS1.
What is the InChIKey of 3-methyldithietan-3-ol?
The InChIKey is QLRWVDQEQOOIAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6OS2/c1-3(4)2-5-6-3/h4H,2H2,1H3.
What are the key properties of 3-methyldithietan-3-ol?
3-methyldithietan-3-ol has a molecular weight of 122.21 g/mol, XLogP of 1.09, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyldithietan-3-ol is sourced from PubChem (CID 156768091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).