C20H17F3N2O2 — CID 156768718
4-methoxy-N-[[2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methyl]aniline (PubChem CID 156768718) has the molecular formula C20H17F3N2O2 and a molecular weight of 374.36 g/mol. Its IUPAC name is 4-methoxy-N-[[2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methyl]aniline.
| Compound Name | 4-methoxy-N-[[2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methyl]aniline |
|---|---|
| PubChem CID | 156768718 |
| Molecular Formula | C20H17F3N2O2 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 4-methoxy-N-[[2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methyl]aniline |
| SMILES | COc1ccc(NCc2coc(/C=C/c3ccc(C(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C20H17F3N2O2/c1-26-18-9-7-16(8-10-18)24-12-17-13-27-19(25-17)11-4-14-2-5-15(6-3-14)20(21,22)23/h2-11,13,24H,12H2,1H3/b11-4+ |
| InChIKey | BHBAKAMXKOEGOS-NYYWCZLTSA-N |
| XLogP | 5.48 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|