C26H26F3NO4 — CID 156769160
2-[(3R)-7-[[4-[(1S,2R)-2-hydroxycyclopentyl]-3-(trifluoromethyl)phenyl]methoxy]-1,2,3,4-tetrahydrocyclopenta[b]indol-3-yl]acetic acid (PubChem CID 156769160) has the molecular formula C26H26F3NO4 and a molecular weight of 473.49 g/mol. Its IUPAC name is 2-[(3R)-7-[[4-[(1S,2R)-2-hydroxycyclopentyl]-3-(trifluoromethyl)phenyl]methoxy]-1,2,3,4-tetrahydrocyclopenta[b]indol-3-yl]acetic acid.
| Compound Name | 2-[(3R)-7-[[4-[(1S,2R)-2-hydroxycyclopentyl]-3-(trifluoromethyl)phenyl]methoxy]-1,2,3,4-tetrahydrocyclopenta[b]indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 156769160 |
| Molecular Formula | C26H26F3NO4 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | 2-[(3R)-7-[[4-[(1S,2R)-2-hydroxycyclopentyl]-3-(trifluoromethyl)phenyl]methoxy]-1,2,3,4-tetrahydrocyclopenta[b]indol-3-yl]acetic acid |
| SMILES | O=C(O)C[C@H]1CCc2c1[nH]c1ccc(OCc3ccc([C@@H]4CCC[C@H]4O)c(C(F)(F)F)c3)cc21 |
| InChI | InChI=1S/C26H26F3NO4/c27-26(28,29)21-10-14(4-7-17(21)18-2-1-3-23(18)31)13-34-16-6-9-22-20(12-16)19-8-5-15(11-24(32)33)25(19)30-22/h4,6-7,9-10,12,15,18,23,30-31H,1-3,5,8,11,13H2,(H,32,33)/t15-,18+,23-/m1/s1 |
| InChIKey | CERFGMXAWIDTOG-KFCXZAFISA-N |
| XLogP | 5.90 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |