About 2-(3,5-difluorophenyl)-4H-3,1-benzoxazine
2-(3,5-difluorophenyl)-4H-3,1-benzoxazine (PubChem CID 156769418) has the molecular formula C14H9F2NO
and a molecular weight of 245.23 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-4H-3,1-benzoxazine.
Molecular Properties
| Compound Name | 2-(3,5-difluorophenyl)-4H-3,1-benzoxazine |
| PubChem CID | 156769418 |
| Molecular Formula | C14H9F2NO |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 2-(3,5-difluorophenyl)-4H-3,1-benzoxazine |
| SMILES | Fc1cc(F)cc(C2=Nc3ccccc3CO2)c1 |
| InChI | InChI=1S/C14H9F2NO/c15-11-5-10(6-12(16)7-11)14-17-13-4-2-1-3-9(13)8-18-14/h1-7H,8H2 |
| InChIKey | QGPZBTYUKRXMFG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3,5-difluorophenyl)-4H-3,1-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-difluorophenyl)-4H-3,1-benzoxazine?
The IUPAC name of 2-(3,5-difluorophenyl)-4H-3,1-benzoxazine (CID 156769418) is 2-(3,5-difluorophenyl)-4H-3,1-benzoxazine.
What is the SMILES notation for 2-(3,5-difluorophenyl)-4H-3,1-benzoxazine?
The canonical SMILES for 2-(3,5-difluorophenyl)-4H-3,1-benzoxazine is Fc1cc(F)cc(C2=Nc3ccccc3CO2)c1.
What is the InChIKey of 2-(3,5-difluorophenyl)-4H-3,1-benzoxazine?
The InChIKey is QGPZBTYUKRXMFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9F2NO/c15-11-5-10(6-12(16)7-11)14-17-13-4-2-1-3-9(13)8-18-14/h1-7H,8H2.
What are the key properties of 2-(3,5-difluorophenyl)-4H-3,1-benzoxazine?
2-(3,5-difluorophenyl)-4H-3,1-benzoxazine has a molecular weight of 245.23 g/mol, XLogP of 3.57, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-difluorophenyl)-4H-3,1-benzoxazine is sourced from PubChem (CID 156769418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).