C7H6F3NO2S2 — CID 156769458
ethyl 2-(trifluoromethylsulfanyl)-1,3-thiazole-5-carboxylate (PubChem CID 156769458) has the molecular formula C7H6F3NO2S2 and a molecular weight of 257.26 g/mol. Its IUPAC name is ethyl 2-(trifluoromethylsulfanyl)-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-(trifluoromethylsulfanyl)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 156769458 |
| Molecular Formula | C7H6F3NO2S2 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 256.98 |
| IUPAC Name | ethyl 2-(trifluoromethylsulfanyl)-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(SC(F)(F)F)s1 |
| InChI | InChI=1S/C7H6F3NO2S2/c1-2-13-5(12)4-3-11-6(14-4)15-7(8,9)10/h3H,2H2,1H3 |
| InChIKey | GMIKJBRZFYEOIP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|