About propan-2-yl 2-methylidenethieno[3,4-d][1,3]dioxole-4-carboxylate
propan-2-yl 2-methylidenethieno[3,4-d][1,3]dioxole-4-carboxylate (PubChem CID 156770249) has the molecular formula C10H10O4S
and a molecular weight of 226.25 g/mol. Its IUPAC name is propan-2-yl 2-methylidenethieno[3,4-d][1,3]dioxole-4-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl 2-methylidenethieno[3,4-d][1,3]dioxole-4-carboxylate |
| PubChem CID | 156770249 |
| Molecular Formula | C10H10O4S |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | propan-2-yl 2-methylidenethieno[3,4-d][1,3]dioxole-4-carboxylate |
| SMILES | C=C1Oc2csc(C(=O)OC(C)C)c2O1 |
| InChI | InChI=1S/C10H10O4S/c1-5(2)12-10(11)9-8-7(4-15-9)13-6(3)14-8/h4-5H,3H2,1-2H3 |
| InChIKey | XYZABKYOHONMIU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze propan-2-yl 2-methylidenethieno[3,4-d][1,3]dioxole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-methylidenethieno[3,4-d][1,3]dioxole-4-carboxylate?
The IUPAC name of propan-2-yl 2-methylidenethieno[3,4-d][1,3]dioxole-4-carboxylate (CID 156770249) is propan-2-yl 2-methylidenethieno[3,4-d][1,3]dioxole-4-carboxylate.
What is the SMILES notation for propan-2-yl 2-methylidenethieno[3,4-d][1,3]dioxole-4-carboxylate?
The canonical SMILES for propan-2-yl 2-methylidenethieno[3,4-d][1,3]dioxole-4-carboxylate is C=C1Oc2csc(C(=O)OC(C)C)c2O1.
What is the InChIKey of propan-2-yl 2-methylidenethieno[3,4-d][1,3]dioxole-4-carboxylate?
The InChIKey is XYZABKYOHONMIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O4S/c1-5(2)12-10(11)9-8-7(4-15-9)13-6(3)14-8/h4-5H,3H2,1-2H3.
What are the key properties of propan-2-yl 2-methylidenethieno[3,4-d][1,3]dioxole-4-carboxylate?
propan-2-yl 2-methylidenethieno[3,4-d][1,3]dioxole-4-carboxylate has a molecular weight of 226.25 g/mol, XLogP of 2.56, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-methylidenethieno[3,4-d][1,3]dioxole-4-carboxylate is sourced from PubChem (CID 156770249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).