About 1-(4,6-dimethoxy-1,3,5-triazin-2-yl)quinolin-1-ium
1-(4,6-dimethoxy-1,3,5-triazin-2-yl)quinolin-1-ium (PubChem CID 156770604) has the molecular formula C14H13N4O2+
and a molecular weight of 269.28 g/mol. Its IUPAC name is 1-(4,6-dimethoxy-1,3,5-triazin-2-yl)quinolin-1-ium.
Molecular Properties
| Compound Name | 1-(4,6-dimethoxy-1,3,5-triazin-2-yl)quinolin-1-ium |
| PubChem CID | 156770604 |
| Molecular Formula | C14H13N4O2+ |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 1-(4,6-dimethoxy-1,3,5-triazin-2-yl)quinolin-1-ium |
| SMILES | COc1nc(OC)nc(-[n+]2cccc3ccccc32)n1 |
| InChI | InChI=1S/C14H13N4O2/c1-19-13-15-12(16-14(17-13)20-2)18-9-5-7-10-6-3-4-8-11(10)18/h3-9H,1-2H3/q+1 |
| InChIKey | YLUIXIXBVZXFGG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 61.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(4,6-dimethoxy-1,3,5-triazin-2-yl)quinolin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,6-dimethoxy-1,3,5-triazin-2-yl)quinolin-1-ium?
The IUPAC name of 1-(4,6-dimethoxy-1,3,5-triazin-2-yl)quinolin-1-ium (CID 156770604) is 1-(4,6-dimethoxy-1,3,5-triazin-2-yl)quinolin-1-ium.
What is the SMILES notation for 1-(4,6-dimethoxy-1,3,5-triazin-2-yl)quinolin-1-ium?
The canonical SMILES for 1-(4,6-dimethoxy-1,3,5-triazin-2-yl)quinolin-1-ium is COc1nc(OC)nc(-[n+]2cccc3ccccc32)n1.
What is the InChIKey of 1-(4,6-dimethoxy-1,3,5-triazin-2-yl)quinolin-1-ium?
The InChIKey is YLUIXIXBVZXFGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N4O2/c1-19-13-15-12(16-14(17-13)20-2)18-9-5-7-10-6-3-4-8-11(10)18/h3-9H,1-2H3/q+1.
What are the key properties of 1-(4,6-dimethoxy-1,3,5-triazin-2-yl)quinolin-1-ium?
1-(4,6-dimethoxy-1,3,5-triazin-2-yl)quinolin-1-ium has a molecular weight of 269.28 g/mol, XLogP of 1.32, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,6-dimethoxy-1,3,5-triazin-2-yl)quinolin-1-ium is sourced from PubChem (CID 156770604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).