About cyclopentylmethyl 2-methylidenebutanoate
cyclopentylmethyl 2-methylidenebutanoate (PubChem CID 156770816) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is cyclopentylmethyl 2-methylidenebutanoate.
Molecular Properties
| Compound Name | cyclopentylmethyl 2-methylidenebutanoate |
| PubChem CID | 156770816 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | cyclopentylmethyl 2-methylidenebutanoate |
| SMILES | C=C(CC)C(=O)OCC1CCCC1 |
| InChI | InChI=1S/C11H18O2/c1-3-9(2)11(12)13-8-10-6-4-5-7-10/h10H,2-8H2,1H3 |
| InChIKey | JXGUZENAEWJUHB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze cyclopentylmethyl 2-methylidenebutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentylmethyl 2-methylidenebutanoate?
The IUPAC name of cyclopentylmethyl 2-methylidenebutanoate (CID 156770816) is cyclopentylmethyl 2-methylidenebutanoate.
What is the SMILES notation for cyclopentylmethyl 2-methylidenebutanoate?
The canonical SMILES for cyclopentylmethyl 2-methylidenebutanoate is C=C(CC)C(=O)OCC1CCCC1.
What is the InChIKey of cyclopentylmethyl 2-methylidenebutanoate?
The InChIKey is JXGUZENAEWJUHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O2/c1-3-9(2)11(12)13-8-10-6-4-5-7-10/h10H,2-8H2,1H3.
What are the key properties of cyclopentylmethyl 2-methylidenebutanoate?
cyclopentylmethyl 2-methylidenebutanoate has a molecular weight of 182.26 g/mol, XLogP of 2.69, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentylmethyl 2-methylidenebutanoate is sourced from PubChem (CID 156770816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).