C23H24O7 — CID 156771972
3,7,9,12-tetrahydroxy-2,2-dimethyl-10-(2-methylbut-3-en-2-yl)-3,4-dihydropyrano[3,2-b]xanthen-6-one (PubChem CID 156771972) has the molecular formula C23H24O7 and a molecular weight of 412.44 g/mol. Its IUPAC name is 3,7,9,12-tetrahydroxy-2,2-dimethyl-10-(2-methylbut-3-en-2-yl)-3,4-dihydropyrano[3,2-b]xanthen-6-one.
| Compound Name | 3,7,9,12-tetrahydroxy-2,2-dimethyl-10-(2-methylbut-3-en-2-yl)-3,4-dihydropyrano[3,2-b]xanthen-6-one |
|---|---|
| PubChem CID | 156771972 |
| Molecular Formula | C23H24O7 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 3,7,9,12-tetrahydroxy-2,2-dimethyl-10-(2-methylbut-3-en-2-yl)-3,4-dihydropyrano[3,2-b]xanthen-6-one |
| SMILES | C=CC(C)(C)c1c(O)cc(O)c2c(=O)c3cc4c(c(O)c3oc12)OC(C)(C)C(O)C4 |
| InChI | InChI=1S/C23H24O7/c1-6-22(2,3)16-13(25)9-12(24)15-17(27)11-7-10-8-14(26)23(4,5)30-19(10)18(28)20(11)29-21(15)16/h6-7,9,14,24-26,28H,1,8H2,2-5H3 |
| InChIKey | SYCHNINGFBBEOB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|