C17H27BClNO2 — CID 156772208
(1S)-1-[[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]methyl]cyclohexa-2,4-dien-1-amine;hydrochloride (PubChem CID 156772208) has the molecular formula C17H27BClNO2 and a molecular weight of 323.67 g/mol. Its IUPAC name is (1S)-1-[[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]methyl]cyclohexa-2,4-dien-1-amine;hydrochloride.
| Compound Name | (1S)-1-[[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]methyl]cyclohexa-2,4-dien-1-amine;hydrochloride |
|---|---|
| PubChem CID | 156772208 |
| Molecular Formula | C17H27BClNO2 |
| Molecular Weight | 323.67 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | (1S)-1-[[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]methyl]cyclohexa-2,4-dien-1-amine;hydrochloride |
| SMILES | CC1(C)[C@H]2C[C@@H]3OB(C[C@@]4(N)C=CC=CC4)O[C@]3(C)[C@@H]1C2.Cl |
| InChI | InChI=1S/C17H26BNO2.ClH/c1-15(2)12-9-13(15)16(3)14(10-12)20-18(21-16)11-17(19)7-5-4-6-8-17;/h4-7,12-14H,8-11,19H2,1-3H3;1H/t12-,13-,14+,16-,17-;/m1./s1 |
| InChIKey | UKMNILKVFKWYEL-SSTOQXFRSA-N |
| XLogP | 3.35 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.67 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|