About spiro[indole-2,2'-pyridine]-3'-one
spiro[indole-2,2'-pyridine]-3'-one (PubChem CID 156772231) has the molecular formula C12H8N2O
and a molecular weight of 196.21 g/mol. Its IUPAC name is spiro[indole-2,2'-pyridine]-3'-one.
Molecular Properties
| Compound Name | spiro[indole-2,2'-pyridine]-3'-one |
| PubChem CID | 156772231 |
| Molecular Formula | C12H8N2O |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | spiro[indole-2,2'-pyridine]-3'-one |
| SMILES | O=C1C=CC=NC12C=c1ccccc1=N2 |
| InChI | InChI=1S/C12H8N2O/c15-11-6-3-7-13-12(11)8-9-4-1-2-5-10(9)14-12/h1-8H |
| InChIKey | XWBMXHLPZPMXRH-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze spiro[indole-2,2'-pyridine]-3'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[indole-2,2'-pyridine]-3'-one?
The IUPAC name of spiro[indole-2,2'-pyridine]-3'-one (CID 156772231) is spiro[indole-2,2'-pyridine]-3'-one.
What is the SMILES notation for spiro[indole-2,2'-pyridine]-3'-one?
The canonical SMILES for spiro[indole-2,2'-pyridine]-3'-one is O=C1C=CC=NC12C=c1ccccc1=N2.
What is the InChIKey of spiro[indole-2,2'-pyridine]-3'-one?
The InChIKey is XWBMXHLPZPMXRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O/c15-11-6-3-7-13-12(11)8-9-4-1-2-5-10(9)14-12/h1-8H.
What are the key properties of spiro[indole-2,2'-pyridine]-3'-one?
spiro[indole-2,2'-pyridine]-3'-one has a molecular weight of 196.21 g/mol, XLogP of 0.01, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[indole-2,2'-pyridine]-3'-one is sourced from PubChem (CID 156772231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).