C9H12O3 — CID 156772375
3-ethyl-4-propylideneoxolane-2,5-dione (PubChem CID 156772375) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is 3-ethyl-4-propylideneoxolane-2,5-dione.
| Compound Name | 3-ethyl-4-propylideneoxolane-2,5-dione |
|---|---|
| PubChem CID | 156772375 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 3-ethyl-4-propylideneoxolane-2,5-dione |
| SMILES | CCC=C1C(=O)OC(=O)C1CC |
| InChI | InChI=1S/C9H12O3/c1-3-5-7-6(4-2)8(10)12-9(7)11/h5-6H,3-4H2,1-2H3 |
| InChIKey | KPLFFCVSWQFGCE-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|