About 4-fluoro-2,5-bis(trifluoromethyl)-1,3-dioxole-2-carboxylic acid
4-fluoro-2,5-bis(trifluoromethyl)-1,3-dioxole-2-carboxylic acid (PubChem CID 156772439) has the molecular formula C6HF7O4
and a molecular weight of 270.06 g/mol. Its IUPAC name is 4-fluoro-2,5-bis(trifluoromethyl)-1,3-dioxole-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-fluoro-2,5-bis(trifluoromethyl)-1,3-dioxole-2-carboxylic acid |
| PubChem CID | 156772439 |
| Molecular Formula | C6HF7O4 |
| Molecular Weight | 270.06 g/mol |
| Exact Mass | 269.98 |
| IUPAC Name | 4-fluoro-2,5-bis(trifluoromethyl)-1,3-dioxole-2-carboxylic acid |
| SMILES | O=C(O)C1(C(F)(F)F)OC(F)=C(C(F)(F)F)O1 |
| InChI | InChI=1S/C6HF7O4/c7-2-1(5(8,9)10)16-4(17-2,3(14)15)6(11,12)13/h(H,14,15) |
| InChIKey | GXQJASUYVZNBAO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.06 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-fluoro-2,5-bis(trifluoromethyl)-1,3-dioxole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-2,5-bis(trifluoromethyl)-1,3-dioxole-2-carboxylic acid?
The IUPAC name of 4-fluoro-2,5-bis(trifluoromethyl)-1,3-dioxole-2-carboxylic acid (CID 156772439) is 4-fluoro-2,5-bis(trifluoromethyl)-1,3-dioxole-2-carboxylic acid.
What is the SMILES notation for 4-fluoro-2,5-bis(trifluoromethyl)-1,3-dioxole-2-carboxylic acid?
The canonical SMILES for 4-fluoro-2,5-bis(trifluoromethyl)-1,3-dioxole-2-carboxylic acid is O=C(O)C1(C(F)(F)F)OC(F)=C(C(F)(F)F)O1.
What is the InChIKey of 4-fluoro-2,5-bis(trifluoromethyl)-1,3-dioxole-2-carboxylic acid?
The InChIKey is GXQJASUYVZNBAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6HF7O4/c7-2-1(5(8,9)10)16-4(17-2,3(14)15)6(11,12)13/h(H,14,15).
What are the key properties of 4-fluoro-2,5-bis(trifluoromethyl)-1,3-dioxole-2-carboxylic acid?
4-fluoro-2,5-bis(trifluoromethyl)-1,3-dioxole-2-carboxylic acid has a molecular weight of 270.06 g/mol, XLogP of 2.08, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-2,5-bis(trifluoromethyl)-1,3-dioxole-2-carboxylic acid is sourced from PubChem (CID 156772439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).