About 2-(ethylamino)butanoic acid
2-(ethylamino)butanoic acid (PubChem CID 15677247) has the molecular formula C6H13NO2
and a molecular weight of 131.18 g/mol. Its IUPAC name is 2-(ethylamino)butanoic acid.
Molecular Properties
| Compound Name | 2-(ethylamino)butanoic acid |
| PubChem CID | 15677247 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | 2-(ethylamino)butanoic acid |
| SMILES | CCNC(CC)C(=O)O |
| InChI | InChI=1S/C6H13NO2/c1-3-5(6(8)9)7-4-2/h5,7H,3-4H2,1-2H3,(H,8,9) |
| InChIKey | PRXQQZUWYABUCX-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(ethylamino)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethylamino)butanoic acid?
The IUPAC name of 2-(ethylamino)butanoic acid (CID 15677247) is 2-(ethylamino)butanoic acid.
What is the SMILES notation for 2-(ethylamino)butanoic acid?
The canonical SMILES for 2-(ethylamino)butanoic acid is CCNC(CC)C(=O)O.
What is the InChIKey of 2-(ethylamino)butanoic acid?
The InChIKey is PRXQQZUWYABUCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO2/c1-3-5(6(8)9)7-4-2/h5,7H,3-4H2,1-2H3,(H,8,9).
What are the key properties of 2-(ethylamino)butanoic acid?
2-(ethylamino)butanoic acid has a molecular weight of 131.18 g/mol, XLogP of 0.46, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethylamino)butanoic acid is sourced from PubChem (CID 15677247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).