2-(ethylamino)pentanoic acid

C7H15NO2 — CID 15677252

IUPAC2-(ethylamino)pentanoic acid
SMILESCCCC(NCC)C(=O)O
InChIInChI=1S/C7H15NO2/c1-3-5-6(7(9)10)8-4-2/h6,8H,3-5H2,1-2H3,(H,9,10)
InChIKeyOSWWTZUPAZDSQH-UHFFFAOYSA-N
MW145.20 g/mol
LogP0.85
Rot. Bonds5

About 2-(ethylamino)pentanoic acid

2-(ethylamino)pentanoic acid (PubChem CID 15677252) has the molecular formula C7H15NO2 and a molecular weight of 145.20 g/mol. Its IUPAC name is 2-(ethylamino)pentanoic acid.

Molecular Properties

Compound Name2-(ethylamino)pentanoic acid
PubChem CID15677252
Molecular FormulaC7H15NO2
Molecular Weight145.20 g/mol
Exact Mass145.11
IUPAC Name2-(ethylamino)pentanoic acid
SMILESCCCC(NCC)C(=O)O
InChIInChI=1S/C7H15NO2/c1-3-5-6(7(9)10)8-4-2/h6,8H,3-5H2,1-2H3,(H,9,10)
InChIKeyOSWWTZUPAZDSQH-UHFFFAOYSA-N
XLogP0.85
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500145.20
LogP ≤ 50.85
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(ethylamino)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(ethylamino)pentanoic acid?
The IUPAC name of 2-(ethylamino)pentanoic acid (CID 15677252) is 2-(ethylamino)pentanoic acid.
What is the SMILES notation for 2-(ethylamino)pentanoic acid?
The canonical SMILES for 2-(ethylamino)pentanoic acid is CCCC(NCC)C(=O)O.
What is the InChIKey of 2-(ethylamino)pentanoic acid?
The InChIKey is OSWWTZUPAZDSQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2/c1-3-5-6(7(9)10)8-4-2/h6,8H,3-5H2,1-2H3,(H,9,10).
What are the key properties of 2-(ethylamino)pentanoic acid?
2-(ethylamino)pentanoic acid has a molecular weight of 145.20 g/mol, XLogP of 0.85, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethylamino)pentanoic acid is sourced from PubChem (CID 15677252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).