About (3,5-dichlorophenyl)methyl 3-(difluoromethyl)-1-methylpyrazole-4-carboxylate
(3,5-dichlorophenyl)methyl 3-(difluoromethyl)-1-methylpyrazole-4-carboxylate (PubChem CID 156772889) has the molecular formula C13H10Cl2F2N2O2
and a molecular weight of 335.14 g/mol. Its IUPAC name is (3,5-dichlorophenyl)methyl 3-(difluoromethyl)-1-methylpyrazole-4-carboxylate.
Molecular Properties
| Compound Name | (3,5-dichlorophenyl)methyl 3-(difluoromethyl)-1-methylpyrazole-4-carboxylate |
| PubChem CID | 156772889 |
| Molecular Formula | C13H10Cl2F2N2O2 |
| Molecular Weight | 335.14 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | (3,5-dichlorophenyl)methyl 3-(difluoromethyl)-1-methylpyrazole-4-carboxylate |
| SMILES | Cn1cc(C(=O)OCc2cc(Cl)cc(Cl)c2)c(C(F)F)n1 |
| InChI | InChI=1S/C13H10Cl2F2N2O2/c1-19-5-10(11(18-19)12(16)17)13(20)21-6-7-2-8(14)4-9(15)3-7/h2-5,12H,6H2,1H3 |
| InChIKey | IVKMKPGGAFIKTD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.14 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3,5-dichlorophenyl)methyl 3-(difluoromethyl)-1-methylpyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dichlorophenyl)methyl 3-(difluoromethyl)-1-methylpyrazole-4-carboxylate?
The IUPAC name of (3,5-dichlorophenyl)methyl 3-(difluoromethyl)-1-methylpyrazole-4-carboxylate (CID 156772889) is (3,5-dichlorophenyl)methyl 3-(difluoromethyl)-1-methylpyrazole-4-carboxylate.
What is the SMILES notation for (3,5-dichlorophenyl)methyl 3-(difluoromethyl)-1-methylpyrazole-4-carboxylate?
The canonical SMILES for (3,5-dichlorophenyl)methyl 3-(difluoromethyl)-1-methylpyrazole-4-carboxylate is Cn1cc(C(=O)OCc2cc(Cl)cc(Cl)c2)c(C(F)F)n1.
What is the InChIKey of (3,5-dichlorophenyl)methyl 3-(difluoromethyl)-1-methylpyrazole-4-carboxylate?
The InChIKey is IVKMKPGGAFIKTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10Cl2F2N2O2/c1-19-5-10(11(18-19)12(16)17)13(20)21-6-7-2-8(14)4-9(15)3-7/h2-5,12H,6H2,1H3.
What are the key properties of (3,5-dichlorophenyl)methyl 3-(difluoromethyl)-1-methylpyrazole-4-carboxylate?
(3,5-dichlorophenyl)methyl 3-(difluoromethyl)-1-methylpyrazole-4-carboxylate has a molecular weight of 335.14 g/mol, XLogP of 4.02, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dichlorophenyl)methyl 3-(difluoromethyl)-1-methylpyrazole-4-carboxylate is sourced from PubChem (CID 156772889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).