C20H16F3N5O3 — CID 156772983
2-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]-N-pyridin-2-ylacetamide (PubChem CID 156772983) has the molecular formula C20H16F3N5O3 and a molecular weight of 431.37 g/mol. Its IUPAC name is 2-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]-N-pyridin-2-ylacetamide.
| Compound Name | 2-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]-N-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 156772983 |
| Molecular Formula | C20H16F3N5O3 |
| Molecular Weight | 431.37 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 2-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]-N-pyridin-2-ylacetamide |
| SMILES | CC1(C)C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C(=O)N1CC(=O)Nc1ccccn1 |
| InChI | InChI=1S/C20H16F3N5O3/c1-19(2)17(30)28(13-7-6-12(10-24)14(9-13)20(21,22)23)18(31)27(19)11-16(29)26-15-5-3-4-8-25-15/h3-9H,11H2,1-2H3,(H,25,26,29) |
| InChIKey | PIKPARQIFAJALC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 106.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|