C6H2ClFN6O6 — CID 156773088
5-chloro-6-(2-fluoro-2,2-dinitroethoxy)-[1,2,5]oxadiazolo[3,4-b]pyrazine (PubChem CID 156773088) has the molecular formula C6H2ClFN6O6 and a molecular weight of 308.57 g/mol. Its IUPAC name is 5-chloro-6-(2-fluoro-2,2-dinitroethoxy)-[1,2,5]oxadiazolo[3,4-b]pyrazine.
| Compound Name | 5-chloro-6-(2-fluoro-2,2-dinitroethoxy)-[1,2,5]oxadiazolo[3,4-b]pyrazine |
|---|---|
| PubChem CID | 156773088 |
| Molecular Formula | C6H2ClFN6O6 |
| Molecular Weight | 308.57 g/mol |
| Exact Mass | 307.97 |
| IUPAC Name | 5-chloro-6-(2-fluoro-2,2-dinitroethoxy)-[1,2,5]oxadiazolo[3,4-b]pyrazine |
| SMILES | O=[N+]([O-])C(F)(COc1nc2nonc2nc1Cl)[N+](=O)[O-] |
| InChI | InChI=1S/C6H2ClFN6O6/c7-2-5(10-4-3(9-2)11-20-12-4)19-1-6(8,13(15)16)14(17)18/h1H2 |
| InChIKey | GEADZJVBIPQFJA-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 160.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.57 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|