C28H38ClIN2O2 — CID 156773267
[(1S)-4-[(1R,3S)-6-chloro-3-phenyl-2,3-dihydro-1H-inden-1-yl]-1,2,2-trimethylpiperazin-1-ium-1-yl]methyl 2,2-dimethylpropanoate iodide (PubChem CID 156773267) has the molecular formula C28H38ClIN2O2 and a molecular weight of 596.98 g/mol. Its IUPAC name is [(1S)-4-[(1R,3S)-6-chloro-3-phenyl-2,3-dihydro-1H-inden-1-yl]-1,2,2-trimethylpiperazin-1-ium-1-yl]methyl 2,2-dimethylpropanoate iodide.
| Compound Name | [(1S)-4-[(1R,3S)-6-chloro-3-phenyl-2,3-dihydro-1H-inden-1-yl]-1,2,2-trimethylpiperazin-1-ium-1-yl]methyl 2,2-dimethylpropanoate iodide |
|---|---|
| PubChem CID | 156773267 |
| Molecular Formula | C28H38ClIN2O2 |
| Molecular Weight | 596.98 g/mol |
| Exact Mass | 596.17 |
| IUPAC Name | [(1S)-4-[(1R,3S)-6-chloro-3-phenyl-2,3-dihydro-1H-inden-1-yl]-1,2,2-trimethylpiperazin-1-ium-1-yl]methyl 2,2-dimethylpropanoate iodide |
| SMILES | CC(C)(C)C(=O)OC[N@@+]1(C)CCN([C@@H]2C[C@@H](c3ccccc3)c3ccc(Cl)cc32)CC1(C)C.[I-] |
| InChI | InChI=1S/C28H38ClN2O2.HI/c1-27(2,3)26(32)33-19-31(6)15-14-30(18-28(31,4)5)25-17-23(20-10-8-7-9-11-20)22-13-12-21(29)16-24(22)25;/h7-13,16,23,25H,14-15,17-19H2,1-6H3;1H/q+1;/p-1/t23-,25+,31+;/m0./s1 |
| InChIKey | OTGVJHDLPAANFS-INMMQVPOSA-M |
| XLogP | 3.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.98 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|