C23H25N7O4 — CID 156773409
4-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]-N-(6-imidazol-1-ylimidazo[1,2-a]pyridin-2-yl)benzamide (PubChem CID 156773409) has the molecular formula C23H25N7O4 and a molecular weight of 463.50 g/mol. Its IUPAC name is 4-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]-N-(6-imidazol-1-ylimidazo[1,2-a]pyridin-2-yl)benzamide.
| Compound Name | 4-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]-N-(6-imidazol-1-ylimidazo[1,2-a]pyridin-2-yl)benzamide |
|---|---|
| PubChem CID | 156773409 |
| Molecular Formula | C23H25N7O4 |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 4-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]-N-(6-imidazol-1-ylimidazo[1,2-a]pyridin-2-yl)benzamide |
| SMILES | NCCOCCOCC(=O)Nc1ccc(C(=O)Nc2cn3cc(-n4ccnc4)ccc3n2)cc1 |
| InChI | InChI=1S/C23H25N7O4/c24-7-10-33-11-12-34-15-22(31)26-18-3-1-17(2-4-18)23(32)28-20-14-30-13-19(5-6-21(30)27-20)29-9-8-25-16-29/h1-6,8-9,13-14,16H,7,10-12,15,24H2,(H,26,31)(H,28,32) |
| InChIKey | BPEZMRIOJRMLPE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 137.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|