About 2-iodo-1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium bromide
2-iodo-1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium bromide (PubChem CID 156773599) has the molecular formula C21H24BrIN2
and a molecular weight of 511.25 g/mol. Its IUPAC name is 2-iodo-1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium bromide.
Molecular Properties
| Compound Name | 2-iodo-1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium bromide |
| PubChem CID | 156773599 |
| Molecular Formula | C21H24BrIN2 |
| Molecular Weight | 511.25 g/mol |
| Exact Mass | 510.02 |
| IUPAC Name | 2-iodo-1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium bromide |
| SMILES | Cc1cc(C)c(-n2cc[n+](-c3c(C)cc(C)cc3C)c2I)c(C)c1.[Br-] |
| InChI | InChI=1S/C21H24IN2.BrH/c1-13-9-15(3)19(16(4)10-13)23-7-8-24(21(23)22)20-17(5)11-14(2)12-18(20)6;/h7-12H,1-6H3;1H/q+1;/p-1 |
| InChIKey | OUNPSGJUPGPXIN-UHFFFAOYSA-M |
| XLogP | 2.21 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 511.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-iodo-1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodo-1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium bromide?
The IUPAC name of 2-iodo-1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium bromide (CID 156773599) is 2-iodo-1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium bromide.
What is the SMILES notation for 2-iodo-1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium bromide?
The canonical SMILES for 2-iodo-1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium bromide is Cc1cc(C)c(-n2cc[n+](-c3c(C)cc(C)cc3C)c2I)c(C)c1.[Br-].
What is the InChIKey of 2-iodo-1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium bromide?
The InChIKey is OUNPSGJUPGPXIN-UHFFFAOYSA-M. The full InChI is InChI=1S/C21H24IN2.BrH/c1-13-9-15(3)19(16(4)10-13)23-7-8-24(21(23)22)20-17(5)11-14(2)12-18(20)6;/h7-12H,1-6H3;1H/q+1;/p-1.
What are the key properties of 2-iodo-1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium bromide?
2-iodo-1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium bromide has a molecular weight of 511.25 g/mol, XLogP of 2.21, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodo-1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium bromide is sourced from PubChem (CID 156773599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).