About 6-cyclobutylpyrimidine-2,4-diamine
6-cyclobutylpyrimidine-2,4-diamine (PubChem CID 156773674) has the molecular formula C8H12N4
and a molecular weight of 164.21 g/mol. Its IUPAC name is 6-cyclobutylpyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 6-cyclobutylpyrimidine-2,4-diamine |
| PubChem CID | 156773674 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 6-cyclobutylpyrimidine-2,4-diamine |
| SMILES | Nc1cc(C2CCC2)nc(N)n1 |
| InChI | InChI=1S/C8H12N4/c9-7-4-6(5-2-1-3-5)11-8(10)12-7/h4-5H,1-3H2,(H4,9,10,11,12) |
| InChIKey | YHLFJSBSPNPQAF-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-cyclobutylpyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclobutylpyrimidine-2,4-diamine?
The IUPAC name of 6-cyclobutylpyrimidine-2,4-diamine (CID 156773674) is 6-cyclobutylpyrimidine-2,4-diamine.
What is the SMILES notation for 6-cyclobutylpyrimidine-2,4-diamine?
The canonical SMILES for 6-cyclobutylpyrimidine-2,4-diamine is Nc1cc(C2CCC2)nc(N)n1.
What is the InChIKey of 6-cyclobutylpyrimidine-2,4-diamine?
The InChIKey is YHLFJSBSPNPQAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4/c9-7-4-6(5-2-1-3-5)11-8(10)12-7/h4-5H,1-3H2,(H4,9,10,11,12).
What are the key properties of 6-cyclobutylpyrimidine-2,4-diamine?
6-cyclobutylpyrimidine-2,4-diamine has a molecular weight of 164.21 g/mol, XLogP of 0.91, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclobutylpyrimidine-2,4-diamine is sourced from PubChem (CID 156773674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).