C17H16F5N3O3S — CID 156774448
2-[(2S,5R)-2-(difluoromethoxymethyl)-5-[4-(trifluoromethyl)phenyl]piperidin-1-yl]-5-nitro-1,3-thiazole (PubChem CID 156774448) has the molecular formula C17H16F5N3O3S and a molecular weight of 437.39 g/mol. Its IUPAC name is 2-[(2S,5R)-2-(difluoromethoxymethyl)-5-[4-(trifluoromethyl)phenyl]piperidin-1-yl]-5-nitro-1,3-thiazole.
| Compound Name | 2-[(2S,5R)-2-(difluoromethoxymethyl)-5-[4-(trifluoromethyl)phenyl]piperidin-1-yl]-5-nitro-1,3-thiazole |
|---|---|
| PubChem CID | 156774448 |
| Molecular Formula | C17H16F5N3O3S |
| Molecular Weight | 437.39 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | 2-[(2S,5R)-2-(difluoromethoxymethyl)-5-[4-(trifluoromethyl)phenyl]piperidin-1-yl]-5-nitro-1,3-thiazole |
| SMILES | O=[N+]([O-])c1cnc(N2C[C@@H](c3ccc(C(F)(F)F)cc3)CC[C@H]2COC(F)F)s1 |
| InChI | InChI=1S/C17H16F5N3O3S/c18-15(19)28-9-13-6-3-11(10-1-4-12(5-2-10)17(20,21)22)8-24(13)16-23-7-14(29-16)25(26)27/h1-2,4-5,7,11,13,15H,3,6,8-9H2/t11-,13-/m0/s1 |
| InChIKey | AFSCKCWJHHMACC-AAEUAGOBSA-N |
| XLogP | 5.06 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.39 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|