About benzyl (2R)-2-amino-3,3-difluoro-2-methylpropanoate
benzyl (2R)-2-amino-3,3-difluoro-2-methylpropanoate (PubChem CID 156775037) has the molecular formula C11H13F2NO2
and a molecular weight of 229.23 g/mol. Its IUPAC name is benzyl (2R)-2-amino-3,3-difluoro-2-methylpropanoate.
Molecular Properties
| Compound Name | benzyl (2R)-2-amino-3,3-difluoro-2-methylpropanoate |
| PubChem CID | 156775037 |
| Molecular Formula | C11H13F2NO2 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | benzyl (2R)-2-amino-3,3-difluoro-2-methylpropanoate |
| SMILES | C[C@@](N)(C(=O)OCc1ccccc1)C(F)F |
| InChI | InChI=1S/C11H13F2NO2/c1-11(14,9(12)13)10(15)16-7-8-5-3-2-4-6-8/h2-6,9H,7,14H2,1H3/t11-/m0/s1 |
| InChIKey | UZSYHQQJMPZVGB-NSHDSACASA-N |
| XLogP | 1.71 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl (2R)-2-amino-3,3-difluoro-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (2R)-2-amino-3,3-difluoro-2-methylpropanoate?
The IUPAC name of benzyl (2R)-2-amino-3,3-difluoro-2-methylpropanoate (CID 156775037) is benzyl (2R)-2-amino-3,3-difluoro-2-methylpropanoate.
What is the SMILES notation for benzyl (2R)-2-amino-3,3-difluoro-2-methylpropanoate?
The canonical SMILES for benzyl (2R)-2-amino-3,3-difluoro-2-methylpropanoate is C[C@@](N)(C(=O)OCc1ccccc1)C(F)F.
What is the InChIKey of benzyl (2R)-2-amino-3,3-difluoro-2-methylpropanoate?
The InChIKey is UZSYHQQJMPZVGB-NSHDSACASA-N. The full InChI is InChI=1S/C11H13F2NO2/c1-11(14,9(12)13)10(15)16-7-8-5-3-2-4-6-8/h2-6,9H,7,14H2,1H3/t11-/m0/s1.
What are the key properties of benzyl (2R)-2-amino-3,3-difluoro-2-methylpropanoate?
benzyl (2R)-2-amino-3,3-difluoro-2-methylpropanoate has a molecular weight of 229.23 g/mol, XLogP of 1.71, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (2R)-2-amino-3,3-difluoro-2-methylpropanoate is sourced from PubChem (CID 156775037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).