About 3'-hydroxy-2-methylspiro[3H-isoquinoline-4,1'-cyclohexane]-1-one
3'-hydroxy-2-methylspiro[3H-isoquinoline-4,1'-cyclohexane]-1-one (PubChem CID 156775286) has the molecular formula C15H19NO2
and a molecular weight of 245.32 g/mol. Its IUPAC name is 3'-hydroxy-2-methylspiro[3H-isoquinoline-4,1'-cyclohexane]-1-one.
Molecular Properties
| Compound Name | 3'-hydroxy-2-methylspiro[3H-isoquinoline-4,1'-cyclohexane]-1-one |
| PubChem CID | 156775286 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 3'-hydroxy-2-methylspiro[3H-isoquinoline-4,1'-cyclohexane]-1-one |
| SMILES | CN1CC2(CCCC(O)C2)c2ccccc2C1=O |
| InChI | InChI=1S/C15H19NO2/c1-16-10-15(8-4-5-11(17)9-15)13-7-3-2-6-12(13)14(16)18/h2-3,6-7,11,17H,4-5,8-10H2,1H3 |
| InChIKey | ITDHYDKYSPIWGA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3'-hydroxy-2-methylspiro[3H-isoquinoline-4,1'-cyclohexane]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3'-hydroxy-2-methylspiro[3H-isoquinoline-4,1'-cyclohexane]-1-one?
The IUPAC name of 3'-hydroxy-2-methylspiro[3H-isoquinoline-4,1'-cyclohexane]-1-one (CID 156775286) is 3'-hydroxy-2-methylspiro[3H-isoquinoline-4,1'-cyclohexane]-1-one.
What is the SMILES notation for 3'-hydroxy-2-methylspiro[3H-isoquinoline-4,1'-cyclohexane]-1-one?
The canonical SMILES for 3'-hydroxy-2-methylspiro[3H-isoquinoline-4,1'-cyclohexane]-1-one is CN1CC2(CCCC(O)C2)c2ccccc2C1=O.
What is the InChIKey of 3'-hydroxy-2-methylspiro[3H-isoquinoline-4,1'-cyclohexane]-1-one?
The InChIKey is ITDHYDKYSPIWGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO2/c1-16-10-15(8-4-5-11(17)9-15)13-7-3-2-6-12(13)14(16)18/h2-3,6-7,11,17H,4-5,8-10H2,1H3.
What are the key properties of 3'-hydroxy-2-methylspiro[3H-isoquinoline-4,1'-cyclohexane]-1-one?
3'-hydroxy-2-methylspiro[3H-isoquinoline-4,1'-cyclohexane]-1-one has a molecular weight of 245.32 g/mol, XLogP of 1.94, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3'-hydroxy-2-methylspiro[3H-isoquinoline-4,1'-cyclohexane]-1-one is sourced from PubChem (CID 156775286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).