C46H69P — CID 156775465
[2,6-bis[2,4,6-tri(propan-2-yl)phenyl]phenyl]-tert-butyl-cyclohexylphosphane (PubChem CID 156775465) has the molecular formula C46H69P and a molecular weight of 653.03 g/mol. Its IUPAC name is [2,6-bis[2,4,6-tri(propan-2-yl)phenyl]phenyl]-tert-butyl-cyclohexylphosphane.
| Compound Name | [2,6-bis[2,4,6-tri(propan-2-yl)phenyl]phenyl]-tert-butyl-cyclohexylphosphane |
|---|---|
| PubChem CID | 156775465 |
| Molecular Formula | C46H69P |
| Molecular Weight | 653.03 g/mol |
| Exact Mass | 652.51 |
| IUPAC Name | [2,6-bis[2,4,6-tri(propan-2-yl)phenyl]phenyl]-tert-butyl-cyclohexylphosphane |
| SMILES | CC(C)c1cc(C(C)C)c(-c2cccc(-c3c(C(C)C)cc(C(C)C)cc3C(C)C)c2P(C2CCCCC2)C(C)(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C46H69P/c1-28(2)34-24-39(30(5)6)43(40(25-34)31(7)8)37-22-19-23-38(45(37)47(46(13,14)15)36-20-17-16-18-21-36)44-41(32(9)10)26-35(29(3)4)27-42(44)33(11)12/h19,22-33,36H,16-18,20-21H2,1-15H3 |
| InChIKey | XEPRATWVMYPJSV-UHFFFAOYSA-N |
| XLogP | 15.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.03 |
| LogP ≤ 5 | 15.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|