About 3,5-dichloro-2,6-dinitro-5-phenylcyclohexa-1,3-diene
3,5-dichloro-2,6-dinitro-5-phenylcyclohexa-1,3-diene (PubChem CID 156775484) has the molecular formula C12H8Cl2N2O4
and a molecular weight of 315.11 g/mol. Its IUPAC name is 3,5-dichloro-2,6-dinitro-5-phenylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 3,5-dichloro-2,6-dinitro-5-phenylcyclohexa-1,3-diene |
| PubChem CID | 156775484 |
| Molecular Formula | C12H8Cl2N2O4 |
| Molecular Weight | 315.11 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | 3,5-dichloro-2,6-dinitro-5-phenylcyclohexa-1,3-diene |
| SMILES | O=[N+]([O-])C1=CC([N+](=O)[O-])C(Cl)(c2ccccc2)C=C1Cl |
| InChI | InChI=1S/C12H8Cl2N2O4/c13-9-7-12(14,8-4-2-1-3-5-8)11(16(19)20)6-10(9)15(17)18/h1-7,11H |
| InChIKey | QKSUNMKXSKPDHI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.11 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dichloro-2,6-dinitro-5-phenylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichloro-2,6-dinitro-5-phenylcyclohexa-1,3-diene?
The IUPAC name of 3,5-dichloro-2,6-dinitro-5-phenylcyclohexa-1,3-diene (CID 156775484) is 3,5-dichloro-2,6-dinitro-5-phenylcyclohexa-1,3-diene.
What is the SMILES notation for 3,5-dichloro-2,6-dinitro-5-phenylcyclohexa-1,3-diene?
The canonical SMILES for 3,5-dichloro-2,6-dinitro-5-phenylcyclohexa-1,3-diene is O=[N+]([O-])C1=CC([N+](=O)[O-])C(Cl)(c2ccccc2)C=C1Cl.
What is the InChIKey of 3,5-dichloro-2,6-dinitro-5-phenylcyclohexa-1,3-diene?
The InChIKey is QKSUNMKXSKPDHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8Cl2N2O4/c13-9-7-12(14,8-4-2-1-3-5-8)11(16(19)20)6-10(9)15(17)18/h1-7,11H.
What are the key properties of 3,5-dichloro-2,6-dinitro-5-phenylcyclohexa-1,3-diene?
3,5-dichloro-2,6-dinitro-5-phenylcyclohexa-1,3-diene has a molecular weight of 315.11 g/mol, XLogP of 3.06, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-2,6-dinitro-5-phenylcyclohexa-1,3-diene is sourced from PubChem (CID 156775484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).