About 6,7-dimethyl-2-propyl-6,7-dihydroquinoxaline
6,7-dimethyl-2-propyl-6,7-dihydroquinoxaline (PubChem CID 156775506) has the molecular formula C13H18N2
and a molecular weight of 202.30 g/mol. Its IUPAC name is 6,7-dimethyl-2-propyl-6,7-dihydroquinoxaline.
Molecular Properties
| Compound Name | 6,7-dimethyl-2-propyl-6,7-dihydroquinoxaline |
| PubChem CID | 156775506 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 6,7-dimethyl-2-propyl-6,7-dihydroquinoxaline |
| SMILES | CCCc1cnc2c(n1)=CC(C)C(C)C=2 |
| InChI | InChI=1S/C13H18N2/c1-4-5-11-8-14-12-6-9(2)10(3)7-13(12)15-11/h6-10H,4-5H2,1-3H3 |
| InChIKey | XPQRWYZLGPZTMZ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,7-dimethyl-2-propyl-6,7-dihydroquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethyl-2-propyl-6,7-dihydroquinoxaline?
The IUPAC name of 6,7-dimethyl-2-propyl-6,7-dihydroquinoxaline (CID 156775506) is 6,7-dimethyl-2-propyl-6,7-dihydroquinoxaline.
What is the SMILES notation for 6,7-dimethyl-2-propyl-6,7-dihydroquinoxaline?
The canonical SMILES for 6,7-dimethyl-2-propyl-6,7-dihydroquinoxaline is CCCc1cnc2c(n1)=CC(C)C(C)C=2.
What is the InChIKey of 6,7-dimethyl-2-propyl-6,7-dihydroquinoxaline?
The InChIKey is XPQRWYZLGPZTMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2/c1-4-5-11-8-14-12-6-9(2)10(3)7-13(12)15-11/h6-10H,4-5H2,1-3H3.
What are the key properties of 6,7-dimethyl-2-propyl-6,7-dihydroquinoxaline?
6,7-dimethyl-2-propyl-6,7-dihydroquinoxaline has a molecular weight of 202.30 g/mol, XLogP of 1.28, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethyl-2-propyl-6,7-dihydroquinoxaline is sourced from PubChem (CID 156775506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).