C9H10N6 — CID 156775753
2-(1,3,5-triazin-2-yl)benzene-1,3,5-triamine (PubChem CID 156775753) has the molecular formula C9H10N6 and a molecular weight of 202.22 g/mol. Its IUPAC name is 2-(1,3,5-triazin-2-yl)benzene-1,3,5-triamine.
| Compound Name | 2-(1,3,5-triazin-2-yl)benzene-1,3,5-triamine |
|---|---|
| PubChem CID | 156775753 |
| Molecular Formula | C9H10N6 |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 2-(1,3,5-triazin-2-yl)benzene-1,3,5-triamine |
| SMILES | Nc1cc(N)c(-c2ncncn2)c(N)c1 |
| InChI | InChI=1S/C9H10N6/c10-5-1-6(11)8(7(12)2-5)9-14-3-13-4-15-9/h1-4H,10-12H2 |
| InChIKey | OZPAQAKNOCIZEH-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|