About ethyl 1-[4-(2,6-dichlorobenzoyl)phenoxy]cyclopropane-1-carboxylate
ethyl 1-[4-(2,6-dichlorobenzoyl)phenoxy]cyclopropane-1-carboxylate (PubChem CID 156776008) has the molecular formula C19H16Cl2O4
and a molecular weight of 379.24 g/mol. Its IUPAC name is ethyl 1-[4-(2,6-dichlorobenzoyl)phenoxy]cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[4-(2,6-dichlorobenzoyl)phenoxy]cyclopropane-1-carboxylate |
| PubChem CID | 156776008 |
| Molecular Formula | C19H16Cl2O4 |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | ethyl 1-[4-(2,6-dichlorobenzoyl)phenoxy]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1(Oc2ccc(C(=O)c3c(Cl)cccc3Cl)cc2)CC1 |
| InChI | InChI=1S/C19H16Cl2O4/c1-2-24-18(23)19(10-11-19)25-13-8-6-12(7-9-13)17(22)16-14(20)4-3-5-15(16)21/h3-9H,2,10-11H2,1H3 |
| InChIKey | DHALFGLFTAINRY-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 1-[4-(2,6-dichlorobenzoyl)phenoxy]cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[4-(2,6-dichlorobenzoyl)phenoxy]cyclopropane-1-carboxylate?
The IUPAC name of ethyl 1-[4-(2,6-dichlorobenzoyl)phenoxy]cyclopropane-1-carboxylate (CID 156776008) is ethyl 1-[4-(2,6-dichlorobenzoyl)phenoxy]cyclopropane-1-carboxylate.
What is the SMILES notation for ethyl 1-[4-(2,6-dichlorobenzoyl)phenoxy]cyclopropane-1-carboxylate?
The canonical SMILES for ethyl 1-[4-(2,6-dichlorobenzoyl)phenoxy]cyclopropane-1-carboxylate is CCOC(=O)C1(Oc2ccc(C(=O)c3c(Cl)cccc3Cl)cc2)CC1.
What is the InChIKey of ethyl 1-[4-(2,6-dichlorobenzoyl)phenoxy]cyclopropane-1-carboxylate?
The InChIKey is DHALFGLFTAINRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16Cl2O4/c1-2-24-18(23)19(10-11-19)25-13-8-6-12(7-9-13)17(22)16-14(20)4-3-5-15(16)21/h3-9H,2,10-11H2,1H3.
What are the key properties of ethyl 1-[4-(2,6-dichlorobenzoyl)phenoxy]cyclopropane-1-carboxylate?
ethyl 1-[4-(2,6-dichlorobenzoyl)phenoxy]cyclopropane-1-carboxylate has a molecular weight of 379.24 g/mol, XLogP of 4.70, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[4-(2,6-dichlorobenzoyl)phenoxy]cyclopropane-1-carboxylate is sourced from PubChem (CID 156776008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).