C19H25N3O — CID 156776033
(2S)-2-[4-(2-methylpropyl)phenyl]-N'-(3-methyl-2-pyridinyl)propanehydrazide (PubChem CID 156776033) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is (2S)-2-[4-(2-methylpropyl)phenyl]-N'-(3-methyl-2-pyridinyl)propanehydrazide.
| Compound Name | (2S)-2-[4-(2-methylpropyl)phenyl]-N'-(3-methyl-2-pyridinyl)propanehydrazide |
|---|---|
| PubChem CID | 156776033 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | (2S)-2-[4-(2-methylpropyl)phenyl]-N'-(3-methyl-2-pyridinyl)propanehydrazide |
| SMILES | Cc1cccnc1NNC(=O)[C@@H](C)c1ccc(CC(C)C)cc1 |
| InChI | InChI=1S/C19H25N3O/c1-13(2)12-16-7-9-17(10-8-16)15(4)19(23)22-21-18-14(3)6-5-11-20-18/h5-11,13,15H,12H2,1-4H3,(H,20,21)(H,22,23)/t15-/m0/s1 |
| InChIKey | OTUFOQZSHKPIQJ-HNNXBMFYSA-N |
| XLogP | 3.84 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|