C21H23NO2 — CID 156776197
methyl 4-(3,5-dicyclopropyl-N-methylanilino)benzoate (PubChem CID 156776197) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is methyl 4-(3,5-dicyclopropyl-N-methylanilino)benzoate.
| Compound Name | methyl 4-(3,5-dicyclopropyl-N-methylanilino)benzoate |
|---|---|
| PubChem CID | 156776197 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | methyl 4-(3,5-dicyclopropyl-N-methylanilino)benzoate |
| SMILES | COC(=O)c1ccc(N(C)c2cc(C3CC3)cc(C3CC3)c2)cc1 |
| InChI | InChI=1S/C21H23NO2/c1-22(19-9-7-16(8-10-19)21(23)24-2)20-12-17(14-3-4-14)11-18(13-20)15-5-6-15/h7-15H,3-6H2,1-2H3 |
| InChIKey | BSLAEEAWPOUWHC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |