C12H23N3O4Si — CID 156777454
(1R,2S,3R,4R,5R)-4-azido-2-[tert-butyl(dimethyl)silyl]oxy-6,8-dioxabicyclo[3.2.1]octan-3-ol (PubChem CID 156777454) has the molecular formula C12H23N3O4Si and a molecular weight of 301.42 g/mol. Its IUPAC name is (1R,2S,3R,4R,5R)-4-azido-2-[tert-butyl(dimethyl)silyl]oxy-6,8-dioxabicyclo[3.2.1]octan-3-ol.
| Compound Name | (1R,2S,3R,4R,5R)-4-azido-2-[tert-butyl(dimethyl)silyl]oxy-6,8-dioxabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 156777454 |
| Molecular Formula | C12H23N3O4Si |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | (1R,2S,3R,4R,5R)-4-azido-2-[tert-butyl(dimethyl)silyl]oxy-6,8-dioxabicyclo[3.2.1]octan-3-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](N=[N+]=[N-])[C@@H]2OC[C@H]1O2 |
| InChI | InChI=1S/C12H23N3O4Si/c1-12(2,3)20(4,5)19-10-7-6-17-11(18-7)8(9(10)16)14-15-13/h7-11,16H,6H2,1-5H3/t7-,8-,9-,10-,11-/m1/s1 |
| InChIKey | LIPXIJOALNMOLF-ISUQUUIWSA-N |
| XLogP | 2.17 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|