C15H18N4O2 — CID 156777823
2-[2,4-diamino-5-[(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)amino]phenoxy]ethanol (PubChem CID 156777823) has the molecular formula C15H18N4O2 and a molecular weight of 286.34 g/mol. Its IUPAC name is 2-[2,4-diamino-5-[(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)amino]phenoxy]ethanol.
| Compound Name | 2-[2,4-diamino-5-[(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)amino]phenoxy]ethanol |
|---|---|
| PubChem CID | 156777823 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 2-[2,4-diamino-5-[(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)amino]phenoxy]ethanol |
| SMILES | [H]/N=C1\C=C/C(=N/c2cc(OCCO)c(N)cc2N)C=C1C |
| InChI | InChI=1S/C15H18N4O2/c1-9-6-10(2-3-11(9)16)19-14-8-15(21-5-4-20)13(18)7-12(14)17/h2-3,6-8,16,20H,4-5,17-18H2,1H3/b16-11+,19-10- |
| InChIKey | QWHIOKHBSYZPCC-ZGQJLEDBSA-N |
| XLogP | 1.83 |
| TPSA | 117.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|