About [(E)-8-(3,3-dimethyloxiran-2-yl)-6-methyloct-5-en-2-yl] 2-methylpropyl carbonate
[(E)-8-(3,3-dimethyloxiran-2-yl)-6-methyloct-5-en-2-yl] 2-methylpropyl carbonate (PubChem CID 15677785) has the molecular formula C18H32O4
and a molecular weight of 312.45 g/mol. Its IUPAC name is [(E)-8-(3,3-dimethyloxiran-2-yl)-6-methyloct-5-en-2-yl] 2-methylpropyl carbonate.
Molecular Properties
| Compound Name | [(E)-8-(3,3-dimethyloxiran-2-yl)-6-methyloct-5-en-2-yl] 2-methylpropyl carbonate |
| PubChem CID | 15677785 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | [(E)-8-(3,3-dimethyloxiran-2-yl)-6-methyloct-5-en-2-yl] 2-methylpropyl carbonate |
| SMILES | C/C(=C\CCC(C)OC(=O)OCC(C)C)CCC1OC1(C)C |
| InChI | InChI=1S/C18H32O4/c1-13(2)12-20-17(19)21-15(4)9-7-8-14(3)10-11-16-18(5,6)22-16/h8,13,15-16H,7,9-12H2,1-6H3/b14-8+ |
| InChIKey | ORKHGKDJTGNFSW-RIYZIHGNSA-N |
| XLogP | 4.87 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [(E)-8-(3,3-dimethyloxiran-2-yl)-6-methyloct-5-en-2-yl] 2-methylpropyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-8-(3,3-dimethyloxiran-2-yl)-6-methyloct-5-en-2-yl] 2-methylpropyl carbonate?
The IUPAC name of [(E)-8-(3,3-dimethyloxiran-2-yl)-6-methyloct-5-en-2-yl] 2-methylpropyl carbonate (CID 15677785) is [(E)-8-(3,3-dimethyloxiran-2-yl)-6-methyloct-5-en-2-yl] 2-methylpropyl carbonate.
What is the SMILES notation for [(E)-8-(3,3-dimethyloxiran-2-yl)-6-methyloct-5-en-2-yl] 2-methylpropyl carbonate?
The canonical SMILES for [(E)-8-(3,3-dimethyloxiran-2-yl)-6-methyloct-5-en-2-yl] 2-methylpropyl carbonate is C/C(=C\CCC(C)OC(=O)OCC(C)C)CCC1OC1(C)C.
What is the InChIKey of [(E)-8-(3,3-dimethyloxiran-2-yl)-6-methyloct-5-en-2-yl] 2-methylpropyl carbonate?
The InChIKey is ORKHGKDJTGNFSW-RIYZIHGNSA-N. The full InChI is InChI=1S/C18H32O4/c1-13(2)12-20-17(19)21-15(4)9-7-8-14(3)10-11-16-18(5,6)22-16/h8,13,15-16H,7,9-12H2,1-6H3/b14-8+.
What are the key properties of [(E)-8-(3,3-dimethyloxiran-2-yl)-6-methyloct-5-en-2-yl] 2-methylpropyl carbonate?
[(E)-8-(3,3-dimethyloxiran-2-yl)-6-methyloct-5-en-2-yl] 2-methylpropyl carbonate has a molecular weight of 312.45 g/mol, XLogP of 4.87, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-8-(3,3-dimethyloxiran-2-yl)-6-methyloct-5-en-2-yl] 2-methylpropyl carbonate is sourced from PubChem (CID 15677785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).