C25H24N4O — CID 156777996
N,N-dimethyl-4-[5-(1,2,3,4-tetrahydroisoquinolin-7-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]benzamide (PubChem CID 156777996) has the molecular formula C25H24N4O and a molecular weight of 396.49 g/mol. Its IUPAC name is N,N-dimethyl-4-[5-(1,2,3,4-tetrahydroisoquinolin-7-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]benzamide.
| Compound Name | N,N-dimethyl-4-[5-(1,2,3,4-tetrahydroisoquinolin-7-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]benzamide |
|---|---|
| PubChem CID | 156777996 |
| Molecular Formula | C25H24N4O |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | N,N-dimethyl-4-[5-(1,2,3,4-tetrahydroisoquinolin-7-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]benzamide |
| SMILES | CN(C)C(=O)c1ccc(-c2c[nH]c3ncc(-c4ccc5c(c4)CNCC5)cc23)cc1 |
| InChI | InChI=1S/C25H24N4O/c1-29(2)25(30)18-6-4-17(5-7-18)23-15-28-24-22(23)12-21(14-27-24)19-8-3-16-9-10-26-13-20(16)11-19/h3-8,11-12,14-15,26H,9-10,13H2,1-2H3,(H,27,28) |
| InChIKey | REEVBWPJNIFJCM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |