About (2E)-N'-(2-butyl-1,3-benzoxazol-6-yl)-2-(fluoromethylidene)propane-1,3-diamine
(2E)-N'-(2-butyl-1,3-benzoxazol-6-yl)-2-(fluoromethylidene)propane-1,3-diamine (PubChem CID 156778574) has the molecular formula C15H20FN3O
and a molecular weight of 277.34 g/mol. Its IUPAC name is (2E)-N'-(2-butyl-1,3-benzoxazol-6-yl)-2-(fluoromethylidene)propane-1,3-diamine.
Molecular Properties
| Compound Name | (2E)-N'-(2-butyl-1,3-benzoxazol-6-yl)-2-(fluoromethylidene)propane-1,3-diamine |
| PubChem CID | 156778574 |
| Molecular Formula | C15H20FN3O |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | (2E)-N'-(2-butyl-1,3-benzoxazol-6-yl)-2-(fluoromethylidene)propane-1,3-diamine |
| SMILES | CCCCc1nc2ccc(NC/C(=C/F)CN)cc2o1 |
| InChI | InChI=1S/C15H20FN3O/c1-2-3-4-15-19-13-6-5-12(7-14(13)20-15)18-10-11(8-16)9-17/h5-8,18H,2-4,9-10,17H2,1H3/b11-8+ |
| InChIKey | RDAIGHUAPIGDJN-DHZHZOJOSA-N |
| XLogP | 3.39 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2E)-N'-(2-butyl-1,3-benzoxazol-6-yl)-2-(fluoromethylidene)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-N'-(2-butyl-1,3-benzoxazol-6-yl)-2-(fluoromethylidene)propane-1,3-diamine?
The IUPAC name of (2E)-N'-(2-butyl-1,3-benzoxazol-6-yl)-2-(fluoromethylidene)propane-1,3-diamine (CID 156778574) is (2E)-N'-(2-butyl-1,3-benzoxazol-6-yl)-2-(fluoromethylidene)propane-1,3-diamine.
What is the SMILES notation for (2E)-N'-(2-butyl-1,3-benzoxazol-6-yl)-2-(fluoromethylidene)propane-1,3-diamine?
The canonical SMILES for (2E)-N'-(2-butyl-1,3-benzoxazol-6-yl)-2-(fluoromethylidene)propane-1,3-diamine is CCCCc1nc2ccc(NC/C(=C/F)CN)cc2o1.
What is the InChIKey of (2E)-N'-(2-butyl-1,3-benzoxazol-6-yl)-2-(fluoromethylidene)propane-1,3-diamine?
The InChIKey is RDAIGHUAPIGDJN-DHZHZOJOSA-N. The full InChI is InChI=1S/C15H20FN3O/c1-2-3-4-15-19-13-6-5-12(7-14(13)20-15)18-10-11(8-16)9-17/h5-8,18H,2-4,9-10,17H2,1H3/b11-8+.
What are the key properties of (2E)-N'-(2-butyl-1,3-benzoxazol-6-yl)-2-(fluoromethylidene)propane-1,3-diamine?
(2E)-N'-(2-butyl-1,3-benzoxazol-6-yl)-2-(fluoromethylidene)propane-1,3-diamine has a molecular weight of 277.34 g/mol, XLogP of 3.39, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-N'-(2-butyl-1,3-benzoxazol-6-yl)-2-(fluoromethylidene)propane-1,3-diamine is sourced from PubChem (CID 156778574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).