About (2E)-N'-(2-butyl-1,3-benzoxazol-6-yl)-2-(fluoromethylidene)-N'-methylpropane-1,3-diamine
(2E)-N'-(2-butyl-1,3-benzoxazol-6-yl)-2-(fluoromethylidene)-N'-methylpropane-1,3-diamine (PubChem CID 156778626) has the molecular formula C16H22FN3O
and a molecular weight of 291.37 g/mol. Its IUPAC name is (2E)-N'-(2-butyl-1,3-benzoxazol-6-yl)-2-(fluoromethylidene)-N'-methylpropane-1,3-diamine.
Molecular Properties
| Compound Name | (2E)-N'-(2-butyl-1,3-benzoxazol-6-yl)-2-(fluoromethylidene)-N'-methylpropane-1,3-diamine |
| PubChem CID | 156778626 |
| Molecular Formula | C16H22FN3O |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | (2E)-N'-(2-butyl-1,3-benzoxazol-6-yl)-2-(fluoromethylidene)-N'-methylpropane-1,3-diamine |
| SMILES | CCCCc1nc2ccc(N(C)C/C(=C/F)CN)cc2o1 |
| InChI | InChI=1S/C16H22FN3O/c1-3-4-5-16-19-14-7-6-13(8-15(14)21-16)20(2)11-12(9-17)10-18/h6-9H,3-5,10-11,18H2,1-2H3/b12-9+ |
| InChIKey | DDGAIZPYMPFPBQ-FMIVXFBMSA-N |
| XLogP | 3.42 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2E)-N'-(2-butyl-1,3-benzoxazol-6-yl)-2-(fluoromethylidene)-N'-methylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-N'-(2-butyl-1,3-benzoxazol-6-yl)-2-(fluoromethylidene)-N'-methylpropane-1,3-diamine?
The IUPAC name of (2E)-N'-(2-butyl-1,3-benzoxazol-6-yl)-2-(fluoromethylidene)-N'-methylpropane-1,3-diamine (CID 156778626) is (2E)-N'-(2-butyl-1,3-benzoxazol-6-yl)-2-(fluoromethylidene)-N'-methylpropane-1,3-diamine.
What is the SMILES notation for (2E)-N'-(2-butyl-1,3-benzoxazol-6-yl)-2-(fluoromethylidene)-N'-methylpropane-1,3-diamine?
The canonical SMILES for (2E)-N'-(2-butyl-1,3-benzoxazol-6-yl)-2-(fluoromethylidene)-N'-methylpropane-1,3-diamine is CCCCc1nc2ccc(N(C)C/C(=C/F)CN)cc2o1.
What is the InChIKey of (2E)-N'-(2-butyl-1,3-benzoxazol-6-yl)-2-(fluoromethylidene)-N'-methylpropane-1,3-diamine?
The InChIKey is DDGAIZPYMPFPBQ-FMIVXFBMSA-N. The full InChI is InChI=1S/C16H22FN3O/c1-3-4-5-16-19-14-7-6-13(8-15(14)21-16)20(2)11-12(9-17)10-18/h6-9H,3-5,10-11,18H2,1-2H3/b12-9+.
What are the key properties of (2E)-N'-(2-butyl-1,3-benzoxazol-6-yl)-2-(fluoromethylidene)-N'-methylpropane-1,3-diamine?
(2E)-N'-(2-butyl-1,3-benzoxazol-6-yl)-2-(fluoromethylidene)-N'-methylpropane-1,3-diamine has a molecular weight of 291.37 g/mol, XLogP of 3.42, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-N'-(2-butyl-1,3-benzoxazol-6-yl)-2-(fluoromethylidene)-N'-methylpropane-1,3-diamine is sourced from PubChem (CID 156778626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).