C14H18O5S — CID 156778715
ethyl 2-(benzylsulfonyloxymethyl)cyclopropane-1-carboxylate (PubChem CID 156778715) has the molecular formula C14H18O5S and a molecular weight of 298.36 g/mol. Its IUPAC name is ethyl 2-(benzylsulfonyloxymethyl)cyclopropane-1-carboxylate.
| Compound Name | ethyl 2-(benzylsulfonyloxymethyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 156778715 |
| Molecular Formula | C14H18O5S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | ethyl 2-(benzylsulfonyloxymethyl)cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1CC1COS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C14H18O5S/c1-2-18-14(15)13-8-12(13)9-19-20(16,17)10-11-6-4-3-5-7-11/h3-7,12-13H,2,8-10H2,1H3 |
| InChIKey | ZHSRYMGREYQVGU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|