C21H15N7O2S3 — CID 156778739
2-[(4-oxo-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-6-yl)sulfanyl]-N-(5-phenylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 156778739) has the molecular formula C21H15N7O2S3 and a molecular weight of 493.60 g/mol. Its IUPAC name is 2-[(4-oxo-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-6-yl)sulfanyl]-N-(5-phenylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[(4-oxo-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-6-yl)sulfanyl]-N-(5-phenylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 156778739 |
| Molecular Formula | C21H15N7O2S3 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.04 |
| IUPAC Name | 2-[(4-oxo-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-6-yl)sulfanyl]-N-(5-phenylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | O=C(CSc1nc2c(cnn2-c2ccccc2)c(=O)[nH]1)Nc1nnc(Sc2ccccc2)s1 |
| InChI | InChI=1S/C21H15N7O2S3/c29-16(23-20-26-27-21(33-20)32-14-9-5-2-6-10-14)12-31-19-24-17-15(18(30)25-19)11-22-28(17)13-7-3-1-4-8-13/h1-11H,12H2,(H,23,26,29)(H,24,25,30) |
| InChIKey | CRZBNUOYFHNBLA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|