About 2-[5-[2-[[3-(trifluoromethyl)phenyl]methoxy]ethylimino]cyclohexa-1,3-dien-1-yl]oxyacetic acid
2-[5-[2-[[3-(trifluoromethyl)phenyl]methoxy]ethylimino]cyclohexa-1,3-dien-1-yl]oxyacetic acid (PubChem CID 156779130) has the molecular formula C18H18F3NO4
and a molecular weight of 369.34 g/mol. Its IUPAC name is 2-[5-[2-[[3-(trifluoromethyl)phenyl]methoxy]ethylimino]cyclohexa-1,3-dien-1-yl]oxyacetic acid.
Molecular Properties
| Compound Name | 2-[5-[2-[[3-(trifluoromethyl)phenyl]methoxy]ethylimino]cyclohexa-1,3-dien-1-yl]oxyacetic acid |
| PubChem CID | 156779130 |
| Molecular Formula | C18H18F3NO4 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 2-[5-[2-[[3-(trifluoromethyl)phenyl]methoxy]ethylimino]cyclohexa-1,3-dien-1-yl]oxyacetic acid |
| SMILES | O=C(O)COC1=CC=C/C(=N/CCOCc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C18H18F3NO4/c19-18(20,21)14-4-1-3-13(9-14)11-25-8-7-22-15-5-2-6-16(10-15)26-12-17(23)24/h1-6,9H,7-8,10-12H2,(H,23,24)/b22-15- |
| InChIKey | LUNSDLLRRVEHTF-JCMHNJIXSA-N |
| XLogP | 3.61 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-[2-[[3-(trifluoromethyl)phenyl]methoxy]ethylimino]cyclohexa-1,3-dien-1-yl]oxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-[2-[[3-(trifluoromethyl)phenyl]methoxy]ethylimino]cyclohexa-1,3-dien-1-yl]oxyacetic acid?
The IUPAC name of 2-[5-[2-[[3-(trifluoromethyl)phenyl]methoxy]ethylimino]cyclohexa-1,3-dien-1-yl]oxyacetic acid (CID 156779130) is 2-[5-[2-[[3-(trifluoromethyl)phenyl]methoxy]ethylimino]cyclohexa-1,3-dien-1-yl]oxyacetic acid.
What is the SMILES notation for 2-[5-[2-[[3-(trifluoromethyl)phenyl]methoxy]ethylimino]cyclohexa-1,3-dien-1-yl]oxyacetic acid?
The canonical SMILES for 2-[5-[2-[[3-(trifluoromethyl)phenyl]methoxy]ethylimino]cyclohexa-1,3-dien-1-yl]oxyacetic acid is O=C(O)COC1=CC=C/C(=N/CCOCc2cccc(C(F)(F)F)c2)C1.
What is the InChIKey of 2-[5-[2-[[3-(trifluoromethyl)phenyl]methoxy]ethylimino]cyclohexa-1,3-dien-1-yl]oxyacetic acid?
The InChIKey is LUNSDLLRRVEHTF-JCMHNJIXSA-N. The full InChI is InChI=1S/C18H18F3NO4/c19-18(20,21)14-4-1-3-13(9-14)11-25-8-7-22-15-5-2-6-16(10-15)26-12-17(23)24/h1-6,9H,7-8,10-12H2,(H,23,24)/b22-15-.
What are the key properties of 2-[5-[2-[[3-(trifluoromethyl)phenyl]methoxy]ethylimino]cyclohexa-1,3-dien-1-yl]oxyacetic acid?
2-[5-[2-[[3-(trifluoromethyl)phenyl]methoxy]ethylimino]cyclohexa-1,3-dien-1-yl]oxyacetic acid has a molecular weight of 369.34 g/mol, XLogP of 3.61, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[2-[[3-(trifluoromethyl)phenyl]methoxy]ethylimino]cyclohexa-1,3-dien-1-yl]oxyacetic acid is sourced from PubChem (CID 156779130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).